cas: 1256955-36-8 — see every product listed under this CAS number, including other names
Methyl 2-amino-4-bromo-5-methoxybenzoate, 97%, 97% (CAS 1256955-36-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OH7-100mg |
| cas | 1256955-36-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1576.40 Pln | |
| Chemat | 25g | 3083.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-amino-4-bromo-5-methoxybenzoate (CAS 1256955-36-8) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: methyl 2-amino-4-bromo-5-methoxybenzoate. InChIKey: VLYQTTVQFZRGQX-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | methyl 2-amino-4-bromo-5-methoxybenzoate |
| InChIKey | VLYQTTVQFZRGQX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)N)Br |
Computed by PubChem (NCBI)