CAS 401792-84-5 appears in our catalog under these names: Methyl 5–(bromomethyl)–6–methoxypicolinate, 5-Bromomethyl-6-methoxy-pyridine-2-carboxylic acid methyl ester, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-(bromomethyl)-6-methoxypyridine-2-carboxylate (CAS 401792-84-5) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: methyl 5-(bromomethyl)-6-methoxypyridine-2-carboxylate. InChIKey: AAORRBUSFSJIDQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | methyl 5-(bromomethyl)-6-methoxypyridine-2-carboxylate |
| InChIKey | AAORRBUSFSJIDQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)C(=O)OC)CBr |
Computed by PubChem (NCBI)