CAS 1824882-25-8 is the registry number for (E)-N-[(4-Bromo-2,6-dimethoxyphenyl)methylidene]hydroxylamine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(NE)-N-[(4-bromo-2,6-dimethoxyphenyl)methylidene]hydroxylamine (CAS 1824882-25-8) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: (NE)-N-[(4-bromo-2,6-dimethoxyphenyl)methylidene]hydroxylamine. InChIKey: JJSLKCCDMFPHNQ-VZUCSPMQSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | (NE)-N-[(4-bromo-2,6-dimethoxyphenyl)methylidene]hydroxylamine |
| InChIKey | JJSLKCCDMFPHNQ-VZUCSPMQSA-N |
| SMILES | COC1=CC(=CC(=C1/C=N/O)OC)Br |
Computed by PubChem (NCBI)