Products 1218526-50-1

CAS 1218526-50-1 is the registry number for 2-Amino-2-(3-bromo-4-methoxyphenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-2-(3-bromo-4-methoxyphenyl)acetic acid (CAS 1218526-50-1) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: 2-amino-2-(3-bromo-4-methoxyphenyl)acetic acid. InChIKey: YUBQGLKBIWHTOC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrNO3
Molecular weight260.08 g/mol
IUPAC name2-amino-2-(3-bromo-4-methoxyphenyl)acetic acid
InChIKeyYUBQGLKBIWHTOC-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(C(=O)O)N)Br

Computed by PubChem (NCBI)