cas: 750585-90-1 — see every product listed under this CAS number, including other names
Methyl 2-bromo-3-(bromomethyl)benzoate 97% (CAS 750585-90-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A532168-250mg |
| cas | 750585-90-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1399.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A532168 |
Methyl 2-bromo-3-(bromomethyl)benzoate (CAS 750585-90-1) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: methyl 2-bromo-3-(bromomethyl)benzoate. InChIKey: LSMBKCOPARGGCS-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | methyl 2-bromo-3-(bromomethyl)benzoate |
| InChIKey | LSMBKCOPARGGCS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1Br)CBr |
Computed by PubChem (NCBI)