Methyl 2-chloro-4-formylbenzoate, 95%
cas: 908248-02-2 — see every product listed under this CAS number, including other names
Methyl 2-chloro-4-formylbenzoate, 95% (CAS 908248-02-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-2720-250mg |
| cas | 908248-02-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 770.88 Pln | |
| Ambeed | 5g | 1972.38 Pln | |
| Ambeed | 10g | 3246.19 Pln | |
| Ambeed | 25g | 6422.38 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1091.60 Pln | |
| Chemat | 5g | 2637.20 Pln | |
| Chemat | 10g | 3923.60 Pln | |
| Chemat | 25g | 7782.80 Pln | |
| BLDpharm | 100mg | 319.91 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 825.29 Pln | |
| BLDpharm | 5g | 2124.83 Pln | |
| BLDpharm | 10g | 3491.02 Pln | |
| BLDpharm | 25g | 6917.59 Pln | |
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 804.94 Pln | |
| Fluorochem | 1g | 2023.26 Pln | |
| Fluorochem | 5g | 4886.84 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 2-chloro-4-formylbenzoate (CAS 908248-02-2) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: methyl 2-chloro-4-formylbenzoate. InChIKey: UTMVVAXABVYJEA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | methyl 2-chloro-4-formylbenzoate |
| InChIKey | UTMVVAXABVYJEA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C=O)Cl |
Computed by PubChem (NCBI)