Products 27914-73-4
CAS 27914-73-4 appears in our catalog under these names: 4-(Chlorocarbonyl)phenyl acetate 95%, Acetic acid-4-chlorocarbonyl-phenyl ester, 96%, Acetic acid 4-chlorocarbonyl-phenyl ester, 95%. Offered by: Ambeed, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-carbonochloridoylphenyl) acetate (CAS 27914-73-4) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: (4-carbonochloridoylphenyl) acetate. InChIKey: CGEOYYBCLBIBLG-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | (4-carbonochloridoylphenyl) acetate |
| InChIKey | CGEOYYBCLBIBLG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
p-acetoxybenzoyl chloride, 4-acetoxybenzoyl chloride, 4-(Acetoxy)benzoyl chloride, 4-(chlorocarbonyl)phenyl acetate, Acetic acid-4-chlorocarbonyl-phenyl ester, (4-carbonochloridoylphenyl) acetate, 4-Acetoxy-benzoylchloride, 4-(carbonochloridoyl)phenyl acetate, acetic acid 4-chlorocarbonyl-phenyl ester, Benzoyl chloride, 4-(acetyloxy)-