CAS 29169-64-0 appears in our catalog under these names: (R)-(-)-O-Formylmandeloyl chloride, 98%, Cefamandole Impurity 6, (R)-2-Chloro-2-oxo-1-phenylethyl formate, 98%+(GC-MS),RG. Offered by: Combi-blocks, Chemat Brand, Fluorochem. Available pack sizes: 25g, 5g, 1g, on request.
[(1R)-2-chloro-2-oxo-1-phenylethyl] formate (CAS 29169-64-0) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: [(1R)-2-chloro-2-oxo-1-phenylethyl] formate. InChIKey: ZNLABNPTWSKGDX-MRVPVSSYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | [(1R)-2-chloro-2-oxo-1-phenylethyl] formate |
| InChIKey | ZNLABNPTWSKGDX-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)Cl)OC=O |
Computed by PubChem (NCBI)