CAS 5538-51-2 appears in our catalog under these names: O-Acetylsalicyloyl chloride, 97%, Aspirin Impurity 19, O-Acetylsalicyloyl Chloride, >95% (HPLC), O–Acetylsalicyloyl Chloride, O-Acetylsalicyloyl chloride, 97% . Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g, on request, 10g, 2,5g, 5g.
(2-carbonochloridoylphenyl) acetate (CAS 5538-51-2) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: (2-carbonochloridoylphenyl) acetate. InChIKey: DSGKWFGEUBCEIE-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | (2-carbonochloridoylphenyl) acetate |
| InChIKey | DSGKWFGEUBCEIE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)Cl |
Computed by PubChem (NCBI)