Methyl 2-chloro-5-(trifluoromethyl)nicotinate, 98%, 98%
cas: 1360934-51-5 — see every product listed under this CAS number, including other names
Methyl 2-chloro-5-(trifluoromethyl)nicotinate, 98%, 98% (CAS 1360934-51-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110VY1-100mg |
| cas | 1360934-51-5 |
| size | 100mg |
| availability | 114.48g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 100g | 2046.80 Pln | |
| Chemat | 50g | 1197.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate (CAS 1360934-51-5) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: methyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: ABTMVRRTSDJRGO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | methyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | ABTMVRRTSDJRGO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)