cas: 1227594-40-2 — see every product listed under this CAS number, including other names
Methyl 2-chloro-6-(trifluoromethyl)isonicotinate, 98%, 98% (CAS 1227594-40-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JD9-10g |
| cas | 1227594-40-2 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 7773.20 Pln | |
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 1667.60 Pln | |
| Chemat | 5g | 4883.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylate (CAS 1227594-40-2) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: methyl 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylate. InChIKey: PPPKCVBFGSHQKD-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | methyl 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylate |
| InChIKey | PPPKCVBFGSHQKD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)