Methyl 2-formyl-3,5-dimethoxybenzoate, 97%
cas: 52344-93-1 — see every product listed under this CAS number, including other names
Methyl 2-formyl-3,5-dimethoxybenzoate, 97% (CAS 52344-93-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A448759-250mg |
| cas | 52344-93-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 915.50 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 578.00 Pln | |
| Chemat | 25g | 1062.80 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 25g | 929.90 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 164.41 Pln | |
| BLDpharm | 5g | 347.68 Pln | |
| BLDpharm | 25g | 980.79 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-formyl-3,5-dimethoxybenzoate (CAS 52344-93-1) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: methyl 2-formyl-3,5-dimethoxybenzoate. InChIKey: HLWARVBOEGPPGB-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | methyl 2-formyl-3,5-dimethoxybenzoate |
| InChIKey | HLWARVBOEGPPGB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C=O)C(=O)OC |
Computed by PubChem (NCBI)