cas: 6326-42-7 — see every product listed under this CAS number, including other names
Methyl 2-iodo-4-nitrobenzoate 95% (CAS 6326-42-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A612167-250mg |
| cas | 6326-42-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 971.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A612167 |
Methyl 2-iodo-4-nitrobenzoate (CAS 6326-42-7) is a chemical compound with the molecular formula C8H6INO4 and a molecular weight of 307.04 g/mol. IUPAC name: methyl 2-iodo-4-nitrobenzoate. InChIKey: KRAIRAIRCFXHRZ-UHFFFAOYSA-N.
| Molecular formula | C8H6INO4 |
|---|---|
| Molecular weight | 307.04 g/mol |
| IUPAC name | methyl 2-iodo-4-nitrobenzoate |
| InChIKey | KRAIRAIRCFXHRZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)