cas: 59115-08-1 — see every product listed under this CAS number, including other names
Methyl 2-methyl-2-(4-nitrophenyl)propanoate 98% (CAS 59115-08-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230971-100mg |
| cas | 59115-08-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2523.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A230971 |
Methyl 2-methyl-2-(4-nitrophenyl)propanoate (CAS 59115-08-1) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: methyl 2-methyl-2-(4-nitrophenyl)propanoate. InChIKey: HSQIFLIPJUZWEO-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | methyl 2-methyl-2-(4-nitrophenyl)propanoate |
| InChIKey | HSQIFLIPJUZWEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)