cas: 1030-33-7 — see every product listed under this CAS number, including other names
Methyl 2-phenylimidazo[1,2-a]pyridine-7-carboxylate (CAS 1030-33-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1106Q1-1g |
| cas | 1030-33-7 |
| size | 1g |
| availability | 2.55g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 12986.00 Pln | |
| Fluorochem | 1g | 21479.95 Pln |
| delivery time | 3 weeks |
|---|
Methyl 2-phenylimidazo[1,2-a]pyridine-7-carboxylate (CAS 1030-33-7) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: methyl 2-phenylimidazo[1,2-a]pyridine-7-carboxylate. InChIKey: NNEHLDZPSCCFBR-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | methyl 2-phenylimidazo[1,2-a]pyridine-7-carboxylate |
| InChIKey | NNEHLDZPSCCFBR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NC(=CN2C=C1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)