cas: 55477-80-0 — see every product listed under this CAS number, including other names
Methyl 2-tert-Butyloxycarbonylaminoacrylate, 98%, 98% (CAS 55477-80-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DEJ8-100mg |
| cas | 55477-80-0 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 50g | 1096.40 Pln | |
| Chemat | 100g | 1922.00 Pln | |
| Chemat | 250g | 3717.20 Pln | |
| Chemat | 500g | 4920.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate (CAS 55477-80-0) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate. InChIKey: MGBHVVGQPZDMHA-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate |
| InChIKey | MGBHVVGQPZDMHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=C)C(=O)OC |
Computed by PubChem (NCBI)