cas: 374537-95-8 — see every product listed under this CAS number, including other names
Methyl 3-(4-(chlorosulfonyl)phenyl)propanoate 98% (CAS 374537-95-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A284253-1g |
| cas | 374537-95-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A284253 |
Methyl 3-(4-chlorosulfonylphenyl)propanoate (CAS 374537-95-8) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: methyl 3-(4-chlorosulfonylphenyl)propanoate. InChIKey: MLBUSWRSGABXFY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | methyl 3-(4-chlorosulfonylphenyl)propanoate |
| InChIKey | MLBUSWRSGABXFY-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)