cas: 2306274-73-5 — see every product listed under this CAS number, including other names
Methyl 3-(4-fluorophenyl)azetidine-3-carboxylate hydrochloride, 97% (CAS 2306274-73-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1490930-1g |
| cas | 2306274-73-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 17080.63 Pln | |
| AmBeed | 250mg | 10225.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-(4-fluorophenyl)azetidine-3-carboxylate;hydrochloride (CAS 2306274-73-5) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)azetidine-3-carboxylate;hydrochloride. InChIKey: BPJBYKMDSVNSLI-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)azetidine-3-carboxylate;hydrochloride |
| InChIKey | BPJBYKMDSVNSLI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CNC1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)