CAS 863870-76-2 is the registry number for 2-Chloro-3-fluorophenylN,N-diethylcarbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(2-chloro-3-fluorophenyl) N,N-diethylcarbamate (CAS 863870-76-2) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: (2-chloro-3-fluorophenyl) N,N-diethylcarbamate. InChIKey: ZIOCGBMHQIIHRJ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | (2-chloro-3-fluorophenyl) N,N-diethylcarbamate |
| InChIKey | ZIOCGBMHQIIHRJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)OC1=C(C(=CC=C1)F)Cl |
Computed by PubChem (NCBI)