cas: 949020-60-4 — see every product listed under this CAS number, including other names
Methyl 3-(4-formyl-3,5-dimethyl-1H-pyrazol-1-yl)propanoate, 95%, 95% (CAS 949020-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JCSW-100mg |
| cas | 949020-60-4 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1014.80 Pln | |
| Chemat | 5g | 3328.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(4-formyl-3,5-dimethylpyrazol-1-yl)propanoate (CAS 949020-60-4) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: methyl 3-(4-formyl-3,5-dimethylpyrazol-1-yl)propanoate. InChIKey: NDUFFKJPKSHLPD-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl 3-(4-formyl-3,5-dimethylpyrazol-1-yl)propanoate |
| InChIKey | NDUFFKJPKSHLPD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCC(=O)OC)C)C=O |
Computed by PubChem (NCBI)