Methyl 3-(bromomethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%
cas: 2058056-24-7 — see every product listed under this CAS number, including other names
Methyl 3-(bromomethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95% (CAS 2058056-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A825456-100mg |
| cas | 2058056-24-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 943.31 Pln | |
| Ambeed | 250mg | 1555.19 Pln | |
| Ambeed | 1g | 3958.19 Pln | |
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1437.20 Pln | |
| Chemat | 1g | 3635.60 Pln | |
| BLDpharm | 100mg | 919.70 Pln | |
| BLDpharm | 250mg | 1530.60 Pln | |
| BLDpharm | 1g | 3885.32 Pln | |
| Fluorochem | 100mg | 1617.16 Pln | |
| Fluorochem | 250mg | 2674.08 Pln | |
| Fluorochem | 1g | 6615.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-(bromomethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2058056-24-7) is a chemical compound with the molecular formula C15H20BBrO4 and a molecular weight of 355.03 g/mol. IUPAC name: methyl 3-(bromomethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VFDQYJDAJPLBRP-UHFFFAOYSA-N.
| Molecular formula | C15H20BBrO4 |
|---|---|
| Molecular weight | 355.03 g/mol |
| IUPAC name | methyl 3-(bromomethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VFDQYJDAJPLBRP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2C(=O)OC)CBr |
Computed by PubChem (NCBI)