CAS 1626407-50-8 appears in our catalog under these names: Methyl 4-(bromomethyl)-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%, Methyl 4-(Bromomethyl)-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 50mg.
Methyl 4-(bromomethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1626407-50-8) is a chemical compound with the molecular formula C15H20BBrO4 and a molecular weight of 355.03 g/mol. IUPAC name: methyl 4-(bromomethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: IZFIPFIGKZZNHR-UHFFFAOYSA-N.
| Molecular formula | C15H20BBrO4 |
|---|---|
| Molecular weight | 355.03 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | IZFIPFIGKZZNHR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)CBr |
Computed by PubChem (NCBI)