CAS 2377610-87-0 appears in our catalog under these names: 3-Bromo-5-methoxycarbonyl-4-methylphenylboronic acid, pinacol ester, 96%, Methyl 3-bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 3-bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2377610-87-0) is a chemical compound with the molecular formula C15H20BBrO4 and a molecular weight of 355.03 g/mol. IUPAC name: methyl 3-bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: KZIROWUEKIPSJL-UHFFFAOYSA-N.
| Molecular formula | C15H20BBrO4 |
|---|---|
| Molecular weight | 355.03 g/mol |
| IUPAC name | methyl 3-bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | KZIROWUEKIPSJL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Br)C)C(=O)OC |
Computed by PubChem (NCBI)