CAS 2096341-94-3 appears in our catalog under these names: 4-Bromo-3-methyl-5-(methoxycarbonyl)phenylboronic acid, pinacol ester, 98%, Methyl 2-bromo-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 2-bromo-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2096341-94-3) is a chemical compound with the molecular formula C15H20BBrO4 and a molecular weight of 355.03 g/mol. IUPAC name: methyl 2-bromo-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VMAKRZVUMPUYLB-UHFFFAOYSA-N.
| Molecular formula | C15H20BBrO4 |
|---|---|
| Molecular weight | 355.03 g/mol |
| IUPAC name | methyl 2-bromo-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VMAKRZVUMPUYLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C(=O)OC)Br)C |
Computed by PubChem (NCBI)