Methyl 3-(ethylamino)-4-nitrobenzoate, 98%
cas: 952183-54-9 — see every product listed under this CAS number, including other names
Methyl 3-(ethylamino)-4-nitrobenzoate, 98% (CAS 952183-54-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A261234-250mg |
| cas | 952183-54-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 448.25 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 480.97 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1263.11 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-(ethylamino)-4-nitrobenzoate (CAS 952183-54-9) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: methyl 3-(ethylamino)-4-nitrobenzoate. InChIKey: MDUFKGRSLMVNCE-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | methyl 3-(ethylamino)-4-nitrobenzoate |
| InChIKey | MDUFKGRSLMVNCE-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=CC(=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)