CAS 70663-55-7 appears in our catalog under these names: N-Me-p-nitro-phe-oh, 95%, (S)-2-(Methylamino)-3-(4-nitrophenyl)propanoic acid, 97%, N–Me–p–nitro–Phe–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
(2S)-2-(methylamino)-3-(4-nitrophenyl)propanoic acid (CAS 70663-55-7) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: (2S)-2-(methylamino)-3-(4-nitrophenyl)propanoic acid. InChIKey: AQKMYHBKZMBFDY-VIFPVBQESA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (2S)-2-(methylamino)-3-(4-nitrophenyl)propanoic acid |
| InChIKey | AQKMYHBKZMBFDY-VIFPVBQESA-N |
| SMILES | CN[C@@H](CC1=CC=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)