CAS 56636-90-9 appears in our catalog under these names: 4-[(2-Nitrophenyl)amino]butanoic acid, 95%, 4-((2-Nitrophenyl)amino)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-(2-nitroanilino)butanoic acid (CAS 56636-90-9) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 4-(2-nitroanilino)butanoic acid. InChIKey: AXVZVHGJXZEPLP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 4-(2-nitroanilino)butanoic acid |
| InChIKey | AXVZVHGJXZEPLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCCCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)