Products 1212908-89-8
CAS 1212908-89-8 is the registry number for Methyl (2S)-2-amino-3-(2-nitrophenyl)propanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-amino-3-(2-nitrophenyl)propanoate (CAS 1212908-89-8) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2-nitrophenyl)propanoate. InChIKey: GVNQFWJRYMDFNR-QMMMGPOBSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2-nitrophenyl)propanoate |
| InChIKey | GVNQFWJRYMDFNR-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)
Synonyms:
2-Nitro-L-phenylalanine Methyl Ester