cas: 234082-16-7 — see every product listed under this CAS number, including other names
Methyl 3-Chloro-4-(Piperazin-1-Yl)Benzoate, ≥95%, ≥95% (CAS 234082-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113N5A-100mg |
| cas | 234082-16-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 966.80 Pln | |
| Chemat | 5g | 2550.80 Pln | |
| Chemat | 10g | 3299.60 Pln | |
| Chemat | 25g | 6242.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-chloro-4-piperazin-1-ylbenzoate (CAS 234082-16-7) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl 3-chloro-4-piperazin-1-ylbenzoate. InChIKey: YXNWWDUBAHLVBO-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl 3-chloro-4-piperazin-1-ylbenzoate |
| InChIKey | YXNWWDUBAHLVBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N2CCNCC2)Cl |
Computed by PubChem (NCBI)