cas: 1142224-62-1 — see every product listed under this CAS number, including other names
Methyl 3-Cyclopropyl-3-(3-hydroxyphenyl)propanoate, >95%, >95% (CAS 1142224-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111AV2-100mg |
| cas | 1142224-62-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 1797.20 Pln | |
| Chemat | 5g | 4101.20 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate (CAS 1142224-62-1) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate. InChIKey: PXBFBXFVUPMAJK-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate |
| InChIKey | PXBFBXFVUPMAJK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1CC1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)