cas: 1142224-62-1 — see every product listed under this CAS number, including other names
Methyl 3-Cyclopropyl-3-(3-hydroxyphenyl)propanoate, 95-<97% (CAS 1142224-62-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1737-95-97-5g |
| cas | 1142224-62-1 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 4282.74 Pln | |
| Hoffman Fine Chemicals | 10g | 6668.86 Pln | |
| Hoffman Fine Chemicals | 25g | 13029.72 Pln | |
| Hoffman Fine Chemicals | 50g | 20660.20 Pln | |
| Hoffman Fine Chemicals | 100g | 34906.74 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate (CAS 1142224-62-1) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate. InChIKey: PXBFBXFVUPMAJK-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate |
| InChIKey | PXBFBXFVUPMAJK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1CC1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)