Methyl 3-benzenesulfonamidobenzoate, 95%
cas: 107922-46-3 — see every product listed under this CAS number, including other names
Methyl 3-benzenesulfonamidobenzoate, 95% (CAS 107922-46-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A361243-10g |
| cas | 107922-46-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 2439.64 Pln | |
| Fluorochem | 10g | 3012.50 Pln | |
| Fluorochem | 25g | 4918.08 Pln | |
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1841.04 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-(benzenesulfonamido)benzoate (CAS 107922-46-3) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: methyl 3-(benzenesulfonamido)benzoate. InChIKey: SPIPPTXOJKWUKC-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | methyl 3-(benzenesulfonamido)benzoate |
| InChIKey | SPIPPTXOJKWUKC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)