cas: 1214337-00-4 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-fluoropicolinate 96% (CAS 1214337-00-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A337910-100mg |
| cas | 1214337-00-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1299.31 Pln | |
| Ambeed | 25g | 4380.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A337910 |
Methyl 3-bromo-5-fluoropyridine-2-carboxylate (CAS 1214337-00-4) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: methyl 3-bromo-5-fluoropyridine-2-carboxylate. InChIKey: BXVIPHUMAZBNSW-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | methyl 3-bromo-5-fluoropyridine-2-carboxylate |
| InChIKey | BXVIPHUMAZBNSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=N1)F)Br |
Computed by PubChem (NCBI)