cas: 478375-40-5 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-methylbenzoate 97% (CAS 478375-40-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199774-100mg |
| cas | 478375-40-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 303.62 Pln | |
| Ambeed | 25g | 631.81 Pln | |
| Ambeed | 100g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199774 |
Methyl 3-bromo-5-methylbenzoate (CAS 478375-40-5) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: methyl 3-bromo-5-methylbenzoate. InChIKey: OAOZBFUAVJUPED-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | methyl 3-bromo-5-methylbenzoate |
| InChIKey | OAOZBFUAVJUPED-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)