Methyl 3-chloro-2-fluoro-5-(trifluoromethyl)benzoate, 97%
cas: 773874-03-6 — see every product listed under this CAS number, including other names
Methyl 3-chloro-2-fluoro-5-(trifluoromethyl)benzoate, 97% (CAS 773874-03-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1328443-250mg |
| cas | 773874-03-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2144.81 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 500mg | 366.80 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1739.60 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 342.13 Pln | |
| BLDpharm | 1g | 758.65 Pln | |
| BLDpharm | 5g | 2308.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-chloro-2-fluoro-5-(trifluoromethyl)benzoate (CAS 773874-03-6) is a chemical compound with the molecular formula C9H5ClF4O2 and a molecular weight of 256.58 g/mol. IUPAC name: methyl 3-chloro-2-fluoro-5-(trifluoromethyl)benzoate. InChIKey: KOIVXIXXADSRRZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF4O2 |
|---|---|
| Molecular weight | 256.58 g/mol |
| IUPAC name | methyl 3-chloro-2-fluoro-5-(trifluoromethyl)benzoate |
| InChIKey | KOIVXIXXADSRRZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)C(F)(F)F)Cl)F |
Computed by PubChem (NCBI)