CAS 1373920-78-5 appears in our catalog under these names: 2-Fluoro-5-methoxy-3-(trifluoromethyl)benzoyl chloride, 95%, 2-Fluoro-5-methoxy-3-(trifluoromethyl)benzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-fluoro-5-methoxy-3-(trifluoromethyl)benzoyl chloride (CAS 1373920-78-5) is a chemical compound with the molecular formula C9H5ClF4O2 and a molecular weight of 256.58 g/mol. IUPAC name: 2-fluoro-5-methoxy-3-(trifluoromethyl)benzoyl chloride. InChIKey: FKJAOSVOAJPKGX-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF4O2 |
|---|---|
| Molecular weight | 256.58 g/mol |
| IUPAC name | 2-fluoro-5-methoxy-3-(trifluoromethyl)benzoyl chloride |
| InChIKey | FKJAOSVOAJPKGX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)Cl |
Computed by PubChem (NCBI)