Products 261763-14-8

CAS 261763-14-8 is the registry number for 3-Chloro-2-fluoro-6-(trifluoromethyl)phenylacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]acetic acid (CAS 261763-14-8) is a chemical compound with the molecular formula C9H5ClF4O2 and a molecular weight of 256.58 g/mol. IUPAC name: 2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]acetic acid. InChIKey: HXBHODMXTYGKEO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClF4O2
Molecular weight256.58 g/mol
IUPAC name2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]acetic acid
InChIKeyHXBHODMXTYGKEO-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(F)(F)F)CC(=O)O)F)Cl

Computed by PubChem (NCBI)