CAS 261763-13-7 appears in our catalog under these names: 3-Chloro-2-fluoro-5-(trifluoromethyl)phenylacetic acid, 95%, 3-Chloro-2-fluoro-5-(trifluoromethyl)phenylacetic acid, 98%, 3–Chloro–2–Fluoro–5–(Trifluoromethyl)Phenylacetic Acid, 3-Chloro-2-Fluoro-5-(Trifluoromethyl)Phenylacetic Acid, 98%+,RG, 98%+,RG, 3-Chloro-2-fluoro-5-(trifluoromethyl)phenylacetic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]acetic acid (CAS 261763-13-7) is a chemical compound with the molecular formula C9H5ClF4O2 and a molecular weight of 256.58 g/mol. IUPAC name: 2-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]acetic acid. InChIKey: ORXABTQTILJYQU-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF4O2 |
|---|---|
| Molecular weight | 256.58 g/mol |
| IUPAC name | 2-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | ORXABTQTILJYQU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CC(=O)O)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)