CAS 35066-32-1 appears in our catalog under these names: Methyl 3-cyano-4-methylbenzoate, 98%, Methyl 3–cyano–4–methylbenzoate, Methyl 3-cyano-4-methylbenzoate, Methyl 3-cyano-4-methylbenzoate, 98%, 98%, Methyl 3-cyano-4-methylbenzoate, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg, 2,5g.
Methyl 3-cyano-4-methylbenzoate (CAS 35066-32-1) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: methyl 3-cyano-4-methylbenzoate. InChIKey: QMGIAFDCHWFQKS-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | methyl 3-cyano-4-methylbenzoate |
| InChIKey | QMGIAFDCHWFQKS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)C#N |
Computed by PubChem (NCBI)