Methyl 3-formyl-2-methoxybenzoate, 95%
cas: 186312-96-9 — see every product listed under this CAS number, including other names
Methyl 3-formyl-2-methoxybenzoate, 95% (CAS 186312-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A189624-100mg |
| cas | 186312-96-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 520.56 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1182.50 Pln | |
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 894.80 Pln | |
| Chemat | 1g | 2142.80 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 1269.58 Pln | |
| Fluorochem | 100mg | 1132.95 Pln | |
| Fluorochem | 250mg | 1664.02 Pln | |
| Fluorochem | 1g | 3965.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-formyl-2-methoxybenzoate (CAS 186312-96-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: methyl 3-formyl-2-methoxybenzoate. InChIKey: VCIXZSDQNCRNMK-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | methyl 3-formyl-2-methoxybenzoate |
| InChIKey | VCIXZSDQNCRNMK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1C(=O)OC)C=O |
Computed by PubChem (NCBI)