cas: 929626-17-5 — see every product listed under this CAS number, including other names
Methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95% (CAS 929626-17-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225813-250MG |
| cas | 929626-17-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 500mg | 320.74 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1247.50 Pln | |
| Fluorochem | 25g | 4163.14 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 929626-17-5) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: PQEGFCISHQGIJO-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | methyl 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | PQEGFCISHQGIJO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)OC)C |
Computed by PubChem (NCBI)