cas: 82523-07-7 — see every product listed under this CAS number, including other names
Methyl 3H-imidazo[4,5-c]pyridine-6-carboxylate 95% (CAS 82523-07-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A419027-100mg |
| cas | 82523-07-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A419027 |
Methyl 3H-imidazo[4,5-c]pyridine-6-carboxylate (CAS 82523-07-7) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: methyl 3H-imidazo[4,5-c]pyridine-6-carboxylate. InChIKey: PTZVKSLCCQTAJE-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | methyl 3H-imidazo[4,5-c]pyridine-6-carboxylate |
| InChIKey | PTZVKSLCCQTAJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C2C(=C1)N=CN2 |
Computed by PubChem (NCBI)