Methyl 4-((2R,4R)-4-hydroxypiperidin-2-yl)benzoate, 95%
cas: 2920187-68-2 — see every product listed under this CAS number, including other names
Methyl 4-((2R,4R)-4-hydroxypiperidin-2-yl)benzoate, 95% (CAS 2920187-68-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1394157-1mg |
| cas | 2920187-68-2 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 270.25 Pln | |
| Ambeed | 5mg | 570.62 Pln | |
| Ambeed | 10mg | 871.00 Pln | |
| Ambeed | 25mg | 1588.56 Pln | |
| Ambeed | 50mg | 2651.00 Pln | |
| Ambeed | 100mg | 4464.38 Pln | |
| Ambeed | 250mg | 7979.87 Pln | |
| Chemat | 5mg | 659.60 Pln | |
| Chemat | 10mg | 1014.80 Pln | |
| Chemat | 25mg | 1869.20 Pln | |
| Chemat | 50mg | 3136.40 Pln | |
| Chemat | 100mg | 5291.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-[(2R,4R)-4-hydroxypiperidin-2-yl]benzoate (CAS 2920187-68-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: methyl 4-[(2R,4R)-4-hydroxypiperidin-2-yl]benzoate. InChIKey: RCTMWTTULRQVQB-VXGBXAGGSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | methyl 4-[(2R,4R)-4-hydroxypiperidin-2-yl]benzoate |
| InChIKey | RCTMWTTULRQVQB-VXGBXAGGSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@H]2C[C@@H](CCN2)O |
Computed by PubChem (NCBI)