CAS 1644667-73-1 is the registry number for Methyl 4-((2S,4S)-4-hydroxypiperidin-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[(2S,4S)-4-hydroxypiperidin-2-yl]benzoate (CAS 1644667-73-1) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: methyl 4-[(2S,4S)-4-hydroxypiperidin-2-yl]benzoate. InChIKey: RCTMWTTULRQVQB-RYUDHWBXSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | methyl 4-[(2S,4S)-4-hydroxypiperidin-2-yl]benzoate |
| InChIKey | RCTMWTTULRQVQB-RYUDHWBXSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@@H]2C[C@H](CCN2)O |
Computed by PubChem (NCBI)