CAS 889996-53-6 is the registry number for Methyl 4–(1–benzofuran–2–yl)–2,4–dioxobutanoate. Offered by: GLPBio. Available pack sizes: 100mg.
Methyl 4-(1-benzofuran-2-yl)-2,4-dioxobutanoate (CAS 889996-53-6) is a chemical compound with the molecular formula C13H10O5 and a molecular weight of 246.21 g/mol. IUPAC name: methyl 4-(1-benzofuran-2-yl)-2,4-dioxobutanoate. InChIKey: VNUSTDVJOALGND-UHFFFAOYSA-N.
| Molecular formula | C13H10O5 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | methyl 4-(1-benzofuran-2-yl)-2,4-dioxobutanoate |
| InChIKey | VNUSTDVJOALGND-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)