cas: 56893-25-5 — see every product listed under this CAS number, including other names
Methyl 4-(2-bromoacetyl)benzoate, 97%, 97% (CAS 56893-25-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148MB-100mg |
| cas | 56893-25-5 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 458.00 Pln | |
| Chemat | 25g | 1024.40 Pln | |
| Chemat | 100g | 2771.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(2-bromoacetyl)benzoate (CAS 56893-25-5) is a chemical compound with the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. IUPAC name: methyl 4-(2-bromoacetyl)benzoate. InChIKey: CHEPDPSMYKFNAN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO3 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | methyl 4-(2-bromoacetyl)benzoate |
| InChIKey | CHEPDPSMYKFNAN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)