cas: 848052-89-1 — see every product listed under this CAS number, including other names
Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate, 97%, 97% (CAS 848052-89-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IDFX-50mg |
| cas | 848052-89-1 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 112.40 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1134.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate (CAS 848052-89-1) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: JCPJQSOTWWRUKR-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | JCPJQSOTWWRUKR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)