cas: 848052-89-1 — see every product listed under this CAS number, including other names
methyl 2-hydroxy-4-(2-methoxyphenyl)-4-oxobut-2-enoate, 97% (CAS 848052-89-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F652263-500MG |
| cas | 848052-89-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 320.74 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 2.5g | 591.48 Pln | |
| Fluorochem | 5g | 893.45 Pln | |
| Fluorochem | 10g | 1393.28 Pln | |
| Fluorochem | 25g | 3402.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate (CAS 848052-89-1) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: JCPJQSOTWWRUKR-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | JCPJQSOTWWRUKR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)