cas: 709648-80-6 — see every product listed under this CAS number, including other names
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl),thiophene-2-carboxylate, 95%, 95% (CAS 709648-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116Q1M-100mg |
| cas | 709648-80-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 500mg | 256.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 3851.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 709648-80-6) is a chemical compound with the molecular formula C12H17BO4S and a molecular weight of 268.14 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: DEUIVNYKDSXHRP-UHFFFAOYSA-N.
| Molecular formula | C12H17BO4S |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | DEUIVNYKDSXHRP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)C(=O)OC |
Computed by PubChem (NCBI)