cas: 1198605-53-6 — see every product listed under this CAS number, including other names
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate, 97% (CAS 1198605-53-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602028-250MG |
| cas | 1198605-53-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 2923.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate (CAS 1198605-53-6) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate. InChIKey: FHFIOJIHWCKHMQ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylate |
| InChIKey | FHFIOJIHWCKHMQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC(=C2)C(=O)OC |
Computed by PubChem (NCBI)